|
Product category: |
Intermediates / Pharmaceutical intermediates |
|
English name: |
3-Chloro-1,2-propanediol |
|
CAS NO: |
96-24-2 |
|
Molecular weight: |
110.5395 |
|
EC NO: |
202-492-4 |
|
Molecular formula: |
C3H7ClO2 |
|
InChI: |
InChI=1/C3H7ClO2/c4-2-1-3(5)6/h3,5-6H,1-2H2 |
|
Specifications: |
99.5% |
|
Packaging: |
250 kg Lined export steel drum |
|
Products: |
3-Chloro-1,2-propanediol presently conform to the internal standards of our company, namely, quality control specifications of the production of 3-Chloro-1,2-propanediol of Inner Mongolia Saintchem Chemicals Limited Company(standard number:Q/NMSTC-A-104-2009). Monthly we produce on an average level 20 tons of first-class 3-Chloro-1,2-propanediol, whose chromatographic purity stands at 99.5%.
|
|
Use: |
Pharmaceutical Intermediates |
|
Alias: |
1-chloro-2,3-dihydroxypropane; 1-chloro-2,3-propanediol; 1-chloropropane-2,3-diol; 2,3-dihydroxypropyl chloride; 3-Chloro-1,2-dihydroxypropane; 3-chloropropane-1,2-diol; 3-Chloropropylene glycol; alpha-chlorohydrin; chlorodeoxyglycerol; Chlorohydrin; Epibloc; glycerine alpha-monochlorohydrin; Glycerol alpha-monochlorohydrin; Glycerol monochlorohydrin; monochlorohydrin; (RS)-3-Chloro-1,2-propanediol; U-5897; 1-chloropropane-1,1-diol; 3-chloropropane-1,1-diol |
|
Structure: |
 |
|
