|
Product category:
|
Intermediates / Pharmaceutical intermediates
|
|
English name:
|
1,3-Diamino-2-hydroxypropane
|
|
CAS NO:
|
616-29-5
|
|
Molecular weight:
|
90.12
|
|
EC NO:
|
210-474-2
|
|
Molecular formula:
|
C3H10N2O
|
|
InChI:
|
InChI=1/C3H10N2O/c4-1-3(6)2-5/h3,6H,1-2,4-5H2/p+2
|
|
Specifications:
|
99.0%
|
|
Packaging:
|
200 kg PE export plastic drum / 25 kg PE export plastic drum
|
|
Use:
|
Pharmaceutical intermediates
|
|
Alias:
|
1,3-Diamino-2-propanol;1,3-diaminopropan-2-ol; 2-hydroxypropane-1,3-diaminium; Diamino-2-propanol, 1,3-
|
|
Structure:
|

|
|